C9H12Cl2O2 — CID 134981280
(3Z,4R,5S)-4-(chloromethyl)-3-(chloromethylidene)-5-propan-2-yloxolan-2-one (PubChem CID 134981280) has the molecular formula C9H12Cl2O2 and a molecular weight of 223.10 g/mol. Its IUPAC name is (3Z,4R,5S)-4-(chloromethyl)-3-(chloromethylidene)-5-propan-2-yloxolan-2-one.
| Compound Name | (3Z,4R,5S)-4-(chloromethyl)-3-(chloromethylidene)-5-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 134981280 |
| Molecular Formula | C9H12Cl2O2 |
| Molecular Weight | 223.10 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | (3Z,4R,5S)-4-(chloromethyl)-3-(chloromethylidene)-5-propan-2-yloxolan-2-one |
| SMILES | CC(C)[C@@H]1OC(=O)/C(=C\Cl)[C@H]1CCl |
| InChI | InChI=1S/C9H12Cl2O2/c1-5(2)8-6(3-10)7(4-11)9(12)13-8/h4-6,8H,3H2,1-2H3/b7-4-/t6-,8+/m1/s1 |
| InChIKey | LGXXZYHIQQTDHG-MOIBXHDPSA-N |
| XLogP | 2.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.10 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|