About methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate
methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate (PubChem CID 134981311) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate |
| PubChem CID | 134981311 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@H](C[C@H](O)CC)O1 |
| InChI | InChI=1S/C12H20O4/c1-4-9(13)7-10-5-6-11(16-10)8(2)12(14)15-3/h9-11,13H,2,4-7H2,1,3H3/t9-,10-,11+/m1/s1 |
| InChIKey | RJFOHZYVVPUPND-MXWKQRLJSA-N |
| XLogP | 1.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate?
The IUPAC name of methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate (CID 134981311) is methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate.
What is the SMILES notation for methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate?
The canonical SMILES for methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate is C=C(C(=O)OC)[C@@H]1CC[C@H](C[C@H](O)CC)O1.
What is the InChIKey of methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate?
The InChIKey is RJFOHZYVVPUPND-MXWKQRLJSA-N. The full InChI is InChI=1S/C12H20O4/c1-4-9(13)7-10-5-6-11(16-10)8(2)12(14)15-3/h9-11,13H,2,4-7H2,1,3H3/t9-,10-,11+/m1/s1.
What are the key properties of methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate?
methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate has a molecular weight of 228.29 g/mol, XLogP of 1.42, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2S,5R)-5-[(2R)-2-hydroxybutyl]oxolan-2-yl]prop-2-enoate is sourced from PubChem (CID 134981311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).