C14H24O4 — CID 134981523
methyl 2-[(2S,5R)-5-[(2S)-2-hydroxy-3,3-dimethylbutyl]oxolan-2-yl]prop-2-enoate (PubChem CID 134981523) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is methyl 2-[(2S,5R)-5-[(2S)-2-hydroxy-3,3-dimethylbutyl]oxolan-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2S,5R)-5-[(2S)-2-hydroxy-3,3-dimethylbutyl]oxolan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 134981523 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | methyl 2-[(2S,5R)-5-[(2S)-2-hydroxy-3,3-dimethylbutyl]oxolan-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@H](C[C@H](O)C(C)(C)C)O1 |
| InChI | InChI=1S/C14H24O4/c1-9(13(16)17-5)11-7-6-10(18-11)8-12(15)14(2,3)4/h10-12,15H,1,6-8H2,2-5H3/t10-,11+,12+/m1/s1 |
| InChIKey | DSSOSUUZPIYJTD-WOPDTQHZSA-N |
| XLogP | 2.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|