C17H29NO — CID 134981792
5-[(Z)-non-2-enyl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 134981792) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 5-[(Z)-non-2-enyl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | 5-[(Z)-non-2-enyl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 134981792 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 5-[(Z)-non-2-enyl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CCCCCC/C=C\CC1CCCC2CCC(=O)N12 |
| InChI | InChI=1S/C17H29NO/c1-2-3-4-5-6-7-8-10-15-11-9-12-16-13-14-17(19)18(15)16/h7-8,15-16H,2-6,9-14H2,1H3/b8-7- |
| InChIKey | FSFYQXDZPHGWNB-FPLPWBNLSA-N |
| XLogP | 4.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|