C24H44O3SiSn — CID 134981806
2-trimethylsilylethyl (2E,6Z)-2-methyl-7-[(2S,3S)-3-[(2S)-2-methyl-4-trimethylstannylpent-4-enyl]oxiran-2-yl]hepta-2,6-dienoate (PubChem CID 134981806) has the molecular formula C24H44O3SiSn and a molecular weight of 527.41 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2E,6Z)-2-methyl-7-[(2S,3S)-3-[(2S)-2-methyl-4-trimethylstannylpent-4-enyl]oxiran-2-yl]hepta-2,6-dienoate.
| Compound Name | 2-trimethylsilylethyl (2E,6Z)-2-methyl-7-[(2S,3S)-3-[(2S)-2-methyl-4-trimethylstannylpent-4-enyl]oxiran-2-yl]hepta-2,6-dienoate |
|---|---|
| PubChem CID | 134981806 |
| Molecular Formula | C24H44O3SiSn |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 2-trimethylsilylethyl (2E,6Z)-2-methyl-7-[(2S,3S)-3-[(2S)-2-methyl-4-trimethylstannylpent-4-enyl]oxiran-2-yl]hepta-2,6-dienoate |
| SMILES | C=C(C[C@@H](C)C[C@@H]1O[C@H]1/C=C\CC/C=C(\C)C(=O)OCC[Si](C)(C)C)[Sn](C)(C)C |
| InChI | InChI=1S/C21H35O3Si.3CH3.Sn/c1-7-11-17(2)16-20-19(24-20)13-10-8-9-12-18(3)21(22)23-14-15-25(4,5)6;;;;/h10,12-13,17,19-20H,1,8-9,11,14-16H2,2-6H3;3*1H3;/b13-10-,18-12+;;;;/t17-,19+,20+;;;;/m1..../s1 |
| InChIKey | VKYCTOINWNRDDE-SOKCVZAPSA-N |
| XLogP | 6.77 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|