C48H72O8 — CID 134981973
3,3-dimethyl-9-[2,3,4-tris(3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-ylidene)cyclobutylidene]-1,5-dioxaspiro[5.5]undecane (PubChem CID 134981973) has the molecular formula C48H72O8 and a molecular weight of 777.10 g/mol. Its IUPAC name is 3,3-dimethyl-9-[2,3,4-tris(3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-ylidene)cyclobutylidene]-1,5-dioxaspiro[5.5]undecane.
| Compound Name | 3,3-dimethyl-9-[2,3,4-tris(3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-ylidene)cyclobutylidene]-1,5-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 134981973 |
| Molecular Formula | C48H72O8 |
| Molecular Weight | 777.10 g/mol |
| Exact Mass | 776.52 |
| IUPAC Name | 3,3-dimethyl-9-[2,3,4-tris(3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-ylidene)cyclobutylidene]-1,5-dioxaspiro[5.5]undecane |
| SMILES | CC1(C)COC2(CCC(=C3C(=C4CCC5(CC4)OCC(C)(C)CO5)C(=C4CCC5(CC4)OCC(C)(C)CO5)C3=C3CCC4(CC3)OCC(C)(C)CO4)CC2)OC1 |
| InChI | InChI=1S/C48H72O8/c1-41(2)25-49-45(50-26-41)17-9-33(10-18-45)37-38(34-11-19-46(20-12-34)51-27-42(3,4)28-52-46)40(36-15-23-48(24-16-36)55-31-44(7,8)32-56-48)39(37)35-13-21-47(22-14-35)53-29-43(5,6)30-54-47/h9-32H2,1-8H3 |
| InChIKey | MPOMTMCSKCIPHX-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.10 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |