About 3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene
3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene (PubChem CID 134981984) has the molecular formula C10H13F3
and a molecular weight of 190.21 g/mol. Its IUPAC name is 3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene.
Analyze 3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene?
The IUPAC name of 3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene (CID 134981984) is 3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene.
What is the SMILES notation for 3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene?
The canonical SMILES for 3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene is C=C(C1=CC(C)CCC1)C(F)(F)F.
What is the InChIKey of 3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene?
The InChIKey is ARYHRHOYLZGZPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3/c1-7-4-3-5-9(6-7)8(2)10(11,12)13/h6-7H,2-5H2,1H3.
What are the key properties of 3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene?
3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene has a molecular weight of 190.21 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(3,3,3-trifluoroprop-1-en-2-yl)cyclohexene is sourced from PubChem (CID 134981984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).