About [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate
[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate (PubChem CID 134982043) has the molecular formula C26H30O5Si
and a molecular weight of 450.61 g/mol. Its IUPAC name is [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate.
Molecular Properties
| Compound Name | [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate |
| PubChem CID | 134982043 |
| Molecular Formula | C26H30O5Si |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate |
| SMILES | COC1(OC(C)=O)C=CC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=CC1=O |
| InChI | InChI=1S/C26H30O5Si/c1-20(27)31-26(29-5)17-16-21(18-24(26)28)19-30-32(25(2,3)4,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-18H,19H2,1-5H3 |
| InChIKey | KCSUCKXMGNSNHO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate?
The IUPAC name of [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate (CID 134982043) is [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate.
What is the SMILES notation for [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate?
The canonical SMILES for [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate is COC1(OC(C)=O)C=CC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=CC1=O.
What is the InChIKey of [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate?
The InChIKey is KCSUCKXMGNSNHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30O5Si/c1-20(27)31-26(29-5)17-16-21(18-24(26)28)19-30-32(25(2,3)4,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-18H,19H2,1-5H3.
What are the key properties of [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate?
[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate has a molecular weight of 450.61 g/mol, XLogP of 3.53, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl] acetate is sourced from PubChem (CID 134982043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).