About 7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one
7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one (PubChem CID 134982117) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is 7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one.
Analyze 7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one?
The IUPAC name of 7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one (CID 134982117) is 7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one.
What is the SMILES notation for 7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one?
The canonical SMILES for 7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one is CC1=C2COCC2=C2COCC2CC1=O.
What is the InChIKey of 7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one?
The InChIKey is DRNOKZFXZGQAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-7-9-4-15-6-11(9)10-5-14-3-8(10)2-12(7)13/h8H,2-6H2,1H3.
What are the key properties of 7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one?
7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one has a molecular weight of 206.24 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4,12-dioxatricyclo[8.3.0.02,6]trideca-1,6-dien-8-one is sourced from PubChem (CID 134982117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).