C20H22O11 — CID 134982178
trimethyl (Z)-4-(5,5-diacetyloxy-6-oxocyclohexa-1,3-dien-1-yl)but-1-ene-1,2,4-tricarboxylate (PubChem CID 134982178) has the molecular formula C20H22O11 and a molecular weight of 438.39 g/mol. Its IUPAC name is trimethyl (Z)-4-(5,5-diacetyloxy-6-oxocyclohexa-1,3-dien-1-yl)but-1-ene-1,2,4-tricarboxylate.
| Compound Name | trimethyl (Z)-4-(5,5-diacetyloxy-6-oxocyclohexa-1,3-dien-1-yl)but-1-ene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 134982178 |
| Molecular Formula | C20H22O11 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | trimethyl (Z)-4-(5,5-diacetyloxy-6-oxocyclohexa-1,3-dien-1-yl)but-1-ene-1,2,4-tricarboxylate |
| SMILES | COC(=O)/C=C(/CC(C(=O)OC)C1=CC=CC(OC(C)=O)(OC(C)=O)C1=O)C(=O)OC |
| InChI | InChI=1S/C20H22O11/c1-11(21)30-20(31-12(2)22)8-6-7-14(17(20)24)15(19(26)29-5)9-13(18(25)28-4)10-16(23)27-3/h6-8,10,15H,9H2,1-5H3/b13-10- |
| InChIKey | APKLGLDAUYBDBA-RAXLEYEMSA-N |
| XLogP | 0.33 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|