C18H28O2 — CID 134982266
2-[(1R,4aS,8aS)-2-ethenyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-1,3-dioxolane (PubChem CID 134982266) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-[(1R,4aS,8aS)-2-ethenyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-1,3-dioxolane.
| Compound Name | 2-[(1R,4aS,8aS)-2-ethenyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 134982266 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2-[(1R,4aS,8aS)-2-ethenyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-1,3-dioxolane |
| SMILES | C=CC1=CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C1OCCO1 |
| InChI | InChI=1S/C18H28O2/c1-5-13-7-8-14-17(2,3)9-6-10-18(14,4)15(13)16-19-11-12-20-16/h5,7,14-16H,1,6,8-12H2,2-4H3/t14-,15+,18-/m0/s1 |
| InChIKey | WMNYNXOBVWQVPT-DAYGRLMNSA-N |
| XLogP | 4.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |