About 4-(butoxymethyl)octa-1,5,6-triene
4-(butoxymethyl)octa-1,5,6-triene (PubChem CID 134982431) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-(butoxymethyl)octa-1,5,6-triene.
Molecular Properties
| Compound Name | 4-(butoxymethyl)octa-1,5,6-triene |
| PubChem CID | 134982431 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 4-(butoxymethyl)octa-1,5,6-triene |
| SMILES | C=CCC(C=C=CC)COCCCC |
| InChI | InChI=1S/C13H22O/c1-4-7-10-13(9-6-3)12-14-11-8-5-2/h4,6,10,13H,3,5,8-9,11-12H2,1-2H3 |
| InChIKey | HGSVREMQNJSQQX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(butoxymethyl)octa-1,5,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butoxymethyl)octa-1,5,6-triene?
The IUPAC name of 4-(butoxymethyl)octa-1,5,6-triene (CID 134982431) is 4-(butoxymethyl)octa-1,5,6-triene.
What is the SMILES notation for 4-(butoxymethyl)octa-1,5,6-triene?
The canonical SMILES for 4-(butoxymethyl)octa-1,5,6-triene is C=CCC(C=C=CC)COCCCC.
What is the InChIKey of 4-(butoxymethyl)octa-1,5,6-triene?
The InChIKey is HGSVREMQNJSQQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O/c1-4-7-10-13(9-6-3)12-14-11-8-5-2/h4,6,10,13H,3,5,8-9,11-12H2,1-2H3.
What are the key properties of 4-(butoxymethyl)octa-1,5,6-triene?
4-(butoxymethyl)octa-1,5,6-triene has a molecular weight of 194.32 g/mol, XLogP of 3.73, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butoxymethyl)octa-1,5,6-triene is sourced from PubChem (CID 134982431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).