About 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene
3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene (PubChem CID 134982576) has the molecular formula C18H21F3O2
and a molecular weight of 326.36 g/mol. Its IUPAC name is 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene.
Molecular Properties
| Compound Name | 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene |
| PubChem CID | 134982576 |
| Molecular Formula | C18H21F3O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene |
| SMILES | COC1=C(C2CCCCC2)c2ccc(C(F)(F)F)cc2C1OC |
| InChI | InChI=1S/C18H21F3O2/c1-22-16-14-10-12(18(19,20)21)8-9-13(14)15(17(16)23-2)11-6-4-3-5-7-11/h8-11,16H,3-7H2,1-2H3 |
| InChIKey | HLQMPQKPSPSHAL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene?
The IUPAC name of 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene (CID 134982576) is 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene.
What is the SMILES notation for 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene?
The canonical SMILES for 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene is COC1=C(C2CCCCC2)c2ccc(C(F)(F)F)cc2C1OC.
What is the InChIKey of 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene?
The InChIKey is HLQMPQKPSPSHAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21F3O2/c1-22-16-14-10-12(18(19,20)21)8-9-13(14)15(17(16)23-2)11-6-4-3-5-7-11/h8-11,16H,3-7H2,1-2H3.
What are the key properties of 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene?
3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene has a molecular weight of 326.36 g/mol, XLogP of 5.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1,2-dimethoxy-6-(trifluoromethyl)-1H-indene is sourced from PubChem (CID 134982576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).