C18H34OSi — CID 134982642
tert-butyl-[(3-butyl-4-ethylcyclopenta-2,4-dien-1-yl)methoxy]-dimethylsilane (PubChem CID 134982642) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is tert-butyl-[(3-butyl-4-ethylcyclopenta-2,4-dien-1-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3-butyl-4-ethylcyclopenta-2,4-dien-1-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134982642 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | tert-butyl-[(3-butyl-4-ethylcyclopenta-2,4-dien-1-yl)methoxy]-dimethylsilane |
| SMILES | CCCCC1=CC(CO[Si](C)(C)C(C)(C)C)C=C1CC |
| InChI | InChI=1S/C18H34OSi/c1-8-10-11-17-13-15(12-16(17)9-2)14-19-20(6,7)18(3,4)5/h12-13,15H,8-11,14H2,1-7H3 |
| InChIKey | HMXDYEGGSDYCAH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|