C22H37NO3 — CID 134982648
tert-butyl (2R,3R)-6-[(1E,3E,5E)-deca-1,3,5-trienyl]-3-methoxy-2-methylpiperidine-1-carboxylate (PubChem CID 134982648) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is tert-butyl (2R,3R)-6-[(1E,3E,5E)-deca-1,3,5-trienyl]-3-methoxy-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-6-[(1E,3E,5E)-deca-1,3,5-trienyl]-3-methoxy-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 134982648 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | tert-butyl (2R,3R)-6-[(1E,3E,5E)-deca-1,3,5-trienyl]-3-methoxy-2-methylpiperidine-1-carboxylate |
| SMILES | CCCC/C=C/C=C/C=C/C1CC[C@@H](OC)[C@@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37NO3/c1-7-8-9-10-11-12-13-14-15-19-16-17-20(25-6)18(2)23(19)21(24)26-22(3,4)5/h10-15,18-20H,7-9,16-17H2,1-6H3/b11-10+,13-12+,15-14+/t18-,19?,20-/m1/s1 |
| InChIKey | HJOXVPHFOAAWJN-BIKFAOBZSA-N |
| XLogP | 5.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|