About (1Z)-1,2-dimethylcyclohexadecene
(1Z)-1,2-dimethylcyclohexadecene (PubChem CID 134982655) has the molecular formula C18H34
and a molecular weight of 250.47 g/mol. Its IUPAC name is (1Z)-1,2-dimethylcyclohexadecene.
Molecular Properties
| Compound Name | (1Z)-1,2-dimethylcyclohexadecene |
| PubChem CID | 134982655 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | (1Z)-1,2-dimethylcyclohexadecene |
| SMILES | C/C1=C(\C)CCCCCCCCCCCCCC1 |
| InChI | InChI=1S/C18H34/c1-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(17)2/h3-16H2,1-2H3/b18-17- |
| InChIKey | GJWZIUZWPDWAJA-ZCXUNETKSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1,2-dimethylcyclohexadecene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1,2-dimethylcyclohexadecene?
The IUPAC name of (1Z)-1,2-dimethylcyclohexadecene (CID 134982655) is (1Z)-1,2-dimethylcyclohexadecene.
What is the SMILES notation for (1Z)-1,2-dimethylcyclohexadecene?
The canonical SMILES for (1Z)-1,2-dimethylcyclohexadecene is C/C1=C(\C)CCCCCCCCCCCCCC1.
What is the InChIKey of (1Z)-1,2-dimethylcyclohexadecene?
The InChIKey is GJWZIUZWPDWAJA-ZCXUNETKSA-N. The full InChI is InChI=1S/C18H34/c1-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(17)2/h3-16H2,1-2H3/b18-17-.
What are the key properties of (1Z)-1,2-dimethylcyclohexadecene?
(1Z)-1,2-dimethylcyclohexadecene has a molecular weight of 250.47 g/mol, XLogP of 6.80, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1,2-dimethylcyclohexadecene is sourced from PubChem (CID 134982655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).