About (1Z)-1,2-dimethylcyclodocosene
(1Z)-1,2-dimethylcyclodocosene (PubChem CID 134982656) has the molecular formula C24H46
and a molecular weight of 334.63 g/mol. Its IUPAC name is (1Z)-1,2-dimethylcyclodocosene.
Molecular Properties
| Compound Name | (1Z)-1,2-dimethylcyclodocosene |
| PubChem CID | 134982656 |
| Molecular Formula | C24H46 |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 334.36 |
| IUPAC Name | (1Z)-1,2-dimethylcyclodocosene |
| SMILES | C/C1=C(\C)CCCCCCCCCCCCCCCCCCCC1 |
| InChI | InChI=1S/C24H46/c1-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24(23)2/h3-22H2,1-2H3/b24-23- |
| InChIKey | JMVLTAYARLZJQP-VHXPQNKSSA-N |
| XLogP | 9.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1,2-dimethylcyclodocosene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1,2-dimethylcyclodocosene?
The IUPAC name of (1Z)-1,2-dimethylcyclodocosene (CID 134982656) is (1Z)-1,2-dimethylcyclodocosene.
What is the SMILES notation for (1Z)-1,2-dimethylcyclodocosene?
The canonical SMILES for (1Z)-1,2-dimethylcyclodocosene is C/C1=C(\C)CCCCCCCCCCCCCCCCCCCC1.
What is the InChIKey of (1Z)-1,2-dimethylcyclodocosene?
The InChIKey is JMVLTAYARLZJQP-VHXPQNKSSA-N. The full InChI is InChI=1S/C24H46/c1-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24(23)2/h3-22H2,1-2H3/b24-23-.
What are the key properties of (1Z)-1,2-dimethylcyclodocosene?
(1Z)-1,2-dimethylcyclodocosene has a molecular weight of 334.63 g/mol, XLogP of 9.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1,2-dimethylcyclodocosene is sourced from PubChem (CID 134982656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).