C18H32 — CID 134982671
(3S,3aR,7aS)-3-nonyl-2,3,3a,4,5,7a-hexahydro-1H-indene (PubChem CID 134982671) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is (3S,3aR,7aS)-3-nonyl-2,3,3a,4,5,7a-hexahydro-1H-indene.
| Compound Name | (3S,3aR,7aS)-3-nonyl-2,3,3a,4,5,7a-hexahydro-1H-indene |
|---|---|
| PubChem CID | 134982671 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | (3S,3aR,7aS)-3-nonyl-2,3,3a,4,5,7a-hexahydro-1H-indene |
| SMILES | CCCCCCCCC[C@H]1CC[C@H]2C=CCC[C@H]12 |
| InChI | InChI=1S/C18H32/c1-2-3-4-5-6-7-8-11-16-14-15-17-12-9-10-13-18(16)17/h9,12,16-18H,2-8,10-11,13-15H2,1H3/t16-,17+,18+/m0/s1 |
| InChIKey | IHQPCYSKBGHNCZ-RCCFBDPRSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|