C18H36O4Si2 — CID 134982677
[(Z)-[(3aR,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]methyl]-trimethylsilane (PubChem CID 134982677) has the molecular formula C18H36O4Si2 and a molecular weight of 372.65 g/mol. Its IUPAC name is [(Z)-[(3aR,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]methyl]-trimethylsilane.
| Compound Name | [(Z)-[(3aR,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]methyl]-trimethylsilane |
|---|---|
| PubChem CID | 134982677 |
| Molecular Formula | C18H36O4Si2 |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | [(Z)-[(3aR,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]methyl]-trimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O/C(=C\[Si](C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C18H36O4Si2/c1-17(2,3)24(9,10)19-11-13-15-16(22-18(4,5)21-15)14(20-13)12-23(6,7)8/h12-13,15-16H,11H2,1-10H3/b14-12-/t13-,15-,16+/m1/s1 |
| InChIKey | RQEAZVPNDLKWFJ-VWYPLXGLSA-N |
| XLogP | 4.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|