C20H27NO2 — CID 134982734
(3R,4R)-4-[(1E,3E,5R,6R)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-3-methylazetidin-2-one (PubChem CID 134982734) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (3R,4R)-4-[(1E,3E,5R,6R)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-3-methylazetidin-2-one.
| Compound Name | (3R,4R)-4-[(1E,3E,5R,6R)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-3-methylazetidin-2-one |
|---|---|
| PubChem CID | 134982734 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (3R,4R)-4-[(1E,3E,5R,6R)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-3-methylazetidin-2-one |
| SMILES | CO[C@H](Cc1ccccc1)[C@H](C)/C=C(C)/C=C/[C@H]1NC(=O)[C@@H]1C |
| InChI | InChI=1S/C20H27NO2/c1-14(10-11-18-16(3)20(22)21-18)12-15(2)19(23-4)13-17-8-6-5-7-9-17/h5-12,15-16,18-19H,13H2,1-4H3,(H,21,22)/b11-10+,14-12+/t15-,16-,18-,19-/m1/s1 |
| InChIKey | WIGUREAAVAVOTD-YEWSTOCWSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|