C45H45N3O9 — CID 134982771
4-[25,26,27-tris(methoxymethoxy)-15,23-dipyridin-4-yl-3,11,19-trioxatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13,15,17(26),21(25),22-nonaen-7-yl]pyridine (PubChem CID 134982771) has the molecular formula C45H45N3O9 and a molecular weight of 771.87 g/mol. Its IUPAC name is 4-[25,26,27-tris(methoxymethoxy)-15,23-dipyridin-4-yl-3,11,19-trioxatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13,15,17(26),21(25),22-nonaen-7-yl]pyridine.
| Compound Name | 4-[25,26,27-tris(methoxymethoxy)-15,23-dipyridin-4-yl-3,11,19-trioxatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13,15,17(26),21(25),22-nonaen-7-yl]pyridine |
|---|---|
| PubChem CID | 134982771 |
| Molecular Formula | C45H45N3O9 |
| Molecular Weight | 771.87 g/mol |
| Exact Mass | 771.32 |
| IUPAC Name | 4-[25,26,27-tris(methoxymethoxy)-15,23-dipyridin-4-yl-3,11,19-trioxatetracyclo[19.3.1.15,9.113,17]heptacosa-1(24),5,7,9(27),13,15,17(26),21(25),22-nonaen-7-yl]pyridine |
| SMILES | COCOc1c2cc(-c3ccncc3)cc1COCc1cc(-c3ccncc3)cc(c1OCOC)COCc1cc(-c3ccncc3)cc(c1OCOC)COC2 |
| InChI | InChI=1S/C45H45N3O9/c1-49-28-55-43-37-16-34(31-4-10-46-11-5-31)17-38(43)23-53-25-40-19-36(33-8-14-48-15-9-33)21-42(45(40)57-30-51-3)27-54-26-41-20-35(32-6-12-47-13-7-32)18-39(24-52-22-37)44(41)56-29-50-2/h4-21H,22-30H2,1-3H3 |
| InChIKey | SHVFEAQKIOEZGK-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 121.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.87 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|