C30H60Si8 — CID 134982829
4,4,7,7,9,9,11,11,13,13,15,15,17,17,20,20-hexadecamethyl-4,7,9,11,13,15,17,20-octasilapentacyclo[10.10.0.02,8.03,21.016,22]docosa-1(12),2(8),3(21),16(22)-tetraene (PubChem CID 134982829) has the molecular formula C30H60Si8 and a molecular weight of 645.50 g/mol. Its IUPAC name is 4,4,7,7,9,9,11,11,13,13,15,15,17,17,20,20-hexadecamethyl-4,7,9,11,13,15,17,20-octasilapentacyclo[10.10.0.02,8.03,21.016,22]docosa-1(12),2(8),3(21),16(22)-tetraene.
| Compound Name | 4,4,7,7,9,9,11,11,13,13,15,15,17,17,20,20-hexadecamethyl-4,7,9,11,13,15,17,20-octasilapentacyclo[10.10.0.02,8.03,21.016,22]docosa-1(12),2(8),3(21),16(22)-tetraene |
|---|---|
| PubChem CID | 134982829 |
| Molecular Formula | C30H60Si8 |
| Molecular Weight | 645.50 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | 4,4,7,7,9,9,11,11,13,13,15,15,17,17,20,20-hexadecamethyl-4,7,9,11,13,15,17,20-octasilapentacyclo[10.10.0.02,8.03,21.016,22]docosa-1(12),2(8),3(21),16(22)-tetraene |
| SMILES | C[Si]1(C)CC[Si](C)(C)C2=C3C4=C([Si](C)(C)C[Si]2(C)C)[Si](C)(C)C[Si](C)(C)C2=C4C(=C31)[Si](C)(C)CC[Si]2(C)C |
| InChI | InChI=1S/C30H60Si8/c1-31(2)17-19-33(5,6)29-24-23-25-27(26(24)31)32(3,4)18-20-34(7,8)30(25)38(15,16)22-36(11,12)28(23)35(9,10)21-37(29,13)14/h17-22H2,1-16H3 |
| InChIKey | IMOIJGRYVPJPPF-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.50 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|