About (1Z)-1,2-dipropylcyclotridecene
(1Z)-1,2-dipropylcyclotridecene (PubChem CID 134982893) has the molecular formula C19H36
and a molecular weight of 264.50 g/mol. Its IUPAC name is (1Z)-1,2-dipropylcyclotridecene.
Molecular Properties
| Compound Name | (1Z)-1,2-dipropylcyclotridecene |
| PubChem CID | 134982893 |
| Molecular Formula | C19H36 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | (1Z)-1,2-dipropylcyclotridecene |
| SMILES | CCC/C1=C(\CCC)CCCCCCCCCCC1 |
| InChI | InChI=1S/C19H36/c1-3-14-18-16-12-10-8-6-5-7-9-11-13-17-19(18)15-4-2/h3-17H2,1-2H3/b19-18- |
| InChIKey | YDZBWFGNYDGTIW-HNENSFHCSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1,2-dipropylcyclotridecene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1,2-dipropylcyclotridecene?
The IUPAC name of (1Z)-1,2-dipropylcyclotridecene (CID 134982893) is (1Z)-1,2-dipropylcyclotridecene.
What is the SMILES notation for (1Z)-1,2-dipropylcyclotridecene?
The canonical SMILES for (1Z)-1,2-dipropylcyclotridecene is CCC/C1=C(\CCC)CCCCCCCCCCC1.
What is the InChIKey of (1Z)-1,2-dipropylcyclotridecene?
The InChIKey is YDZBWFGNYDGTIW-HNENSFHCSA-N. The full InChI is InChI=1S/C19H36/c1-3-14-18-16-12-10-8-6-5-7-9-11-13-17-19(18)15-4-2/h3-17H2,1-2H3/b19-18-.
What are the key properties of (1Z)-1,2-dipropylcyclotridecene?
(1Z)-1,2-dipropylcyclotridecene has a molecular weight of 264.50 g/mol, XLogP of 7.19, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1,2-dipropylcyclotridecene is sourced from PubChem (CID 134982893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).