C10H6N2 — CID 134982930
(1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2-dicarbonitrile (PubChem CID 134982930) has the molecular formula C10H6N2 and a molecular weight of 154.17 g/mol. Its IUPAC name is (1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2-dicarbonitrile.
| Compound Name | (1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 134982930 |
| Molecular Formula | C10H6N2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | (1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2-dicarbonitrile |
| SMILES | N#CC1=C(C#N)/C=C\C=C/C=C\1 |
| InChI | InChI=1S/C10H6N2/c11-7-9-5-3-1-2-4-6-10(9)8-12/h1-6H/b2-1-,3-1-,4-2-,5-3-,6-4-,9-5-,10-6-,10-9- |
| InChIKey | YLZPUPNXNFRPNY-GNGASDGLSA-N |
| XLogP | 2.01 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |