C15H24O2 — CID 134982977
(1S,6S)-7-(methoxymethyl)-1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene (PubChem CID 134982977) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is (1S,6S)-7-(methoxymethyl)-1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene.
| Compound Name | (1S,6S)-7-(methoxymethyl)-1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene |
|---|---|
| PubChem CID | 134982977 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1S,6S)-7-(methoxymethyl)-1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene |
| SMILES | COCC1=C[C@@]2(OC(C)C)C=C[C@@H]1CCCC2 |
| InChI | InChI=1S/C15H24O2/c1-12(2)17-15-8-5-4-6-13(7-9-15)14(10-15)11-16-3/h7,9-10,12-13H,4-6,8,11H2,1-3H3/t13-,15-/m0/s1 |
| InChIKey | HBRHYGRKTZVTOX-ZFWWWQNUSA-N |
| XLogP | 3.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|