C14H30OSi — CID 134983005
tert-butyl-[(E)-6,6,7,7,8,8,8-heptadeuteriooct-4-enoxy]-dimethylsilane (PubChem CID 134983005) has the molecular formula C14H30OSi and a molecular weight of 249.52 g/mol. Its IUPAC name is tert-butyl-[(E)-6,6,7,7,8,8,8-heptadeuteriooct-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-6,6,7,7,8,8,8-heptadeuteriooct-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134983005 |
| Molecular Formula | C14H30OSi |
| Molecular Weight | 249.52 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | tert-butyl-[(E)-6,6,7,7,8,8,8-heptadeuteriooct-4-enoxy]-dimethylsilane |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])/C=C/CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30OSi/c1-7-8-9-10-11-12-13-15-16(5,6)14(2,3)4/h9-10H,7-8,11-13H2,1-6H3/b10-9+/i1D3,7D2,8D2 |
| InChIKey | CUSUGLDSESHKTN-NOFXUNRHSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|