C27H45NO5 — CID 134983244
tert-butyl N-[(2E,4E,6S,7S,8Z,10E,12S,15Z)-6,17-dihydroxy-12-methoxy-2,5,7,16-tetramethylheptadeca-2,4,8,10,15-pentaenyl]carbamate (PubChem CID 134983244) has the molecular formula C27H45NO5 and a molecular weight of 463.66 g/mol. Its IUPAC name is tert-butyl N-[(2E,4E,6S,7S,8Z,10E,12S,15Z)-6,17-dihydroxy-12-methoxy-2,5,7,16-tetramethylheptadeca-2,4,8,10,15-pentaenyl]carbamate.
| Compound Name | tert-butyl N-[(2E,4E,6S,7S,8Z,10E,12S,15Z)-6,17-dihydroxy-12-methoxy-2,5,7,16-tetramethylheptadeca-2,4,8,10,15-pentaenyl]carbamate |
|---|---|
| PubChem CID | 134983244 |
| Molecular Formula | C27H45NO5 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.33 |
| IUPAC Name | tert-butyl N-[(2E,4E,6S,7S,8Z,10E,12S,15Z)-6,17-dihydroxy-12-methoxy-2,5,7,16-tetramethylheptadeca-2,4,8,10,15-pentaenyl]carbamate |
| SMILES | CO[C@H](/C=C/C=C\[C@H](C)[C@H](O)/C(C)=C/C=C(\C)CNC(=O)OC(C)(C)C)CC/C=C(/C)CO |
| InChI | InChI=1S/C27H45NO5/c1-20(18-28-26(31)33-27(5,6)7)16-17-23(4)25(30)22(3)13-9-10-14-24(32-8)15-11-12-21(2)19-29/h9-10,12-14,16-17,22,24-25,29-30H,11,15,18-19H2,1-8H3,(H,28,31)/b13-9-,14-10+,20-16+,21-12-,23-17+/t22-,24+,25-/m0/s1 |
| InChIKey | AALRWKPOELHZIE-VDGGXALFSA-N |
| XLogP | 5.25 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|