C22H27NO4S — CID 134983253
(E)-7-[1-(4-methylphenyl)sulfonyl-4-[(E)-3-oxobut-1-enyl]-2,5-dihydropyrrol-2-yl]hept-3-en-2-one (PubChem CID 134983253) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is (E)-7-[1-(4-methylphenyl)sulfonyl-4-[(E)-3-oxobut-1-enyl]-2,5-dihydropyrrol-2-yl]hept-3-en-2-one.
| Compound Name | (E)-7-[1-(4-methylphenyl)sulfonyl-4-[(E)-3-oxobut-1-enyl]-2,5-dihydropyrrol-2-yl]hept-3-en-2-one |
|---|---|
| PubChem CID | 134983253 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (E)-7-[1-(4-methylphenyl)sulfonyl-4-[(E)-3-oxobut-1-enyl]-2,5-dihydropyrrol-2-yl]hept-3-en-2-one |
| SMILES | CC(=O)/C=C/CCCC1C=C(/C=C/C(C)=O)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H27NO4S/c1-17-9-13-22(14-10-17)28(26,27)23-16-20(12-11-19(3)25)15-21(23)8-6-4-5-7-18(2)24/h5,7,9-15,21H,4,6,8,16H2,1-3H3/b7-5+,12-11+ |
| InChIKey | UWCGJYVFMBCVRO-MCZQWLMRSA-N |
| XLogP | 3.76 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|