C20H25NO3S — CID 134983254
(E)-7-[4-ethenyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-2-yl]hept-3-en-2-one (PubChem CID 134983254) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is (E)-7-[4-ethenyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-2-yl]hept-3-en-2-one.
| Compound Name | (E)-7-[4-ethenyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-2-yl]hept-3-en-2-one |
|---|---|
| PubChem CID | 134983254 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (E)-7-[4-ethenyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-2-yl]hept-3-en-2-one |
| SMILES | C=CC1=CC(CCC/C=C/C(C)=O)N(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C20H25NO3S/c1-4-18-14-19(9-7-5-6-8-17(3)22)21(15-18)25(23,24)20-12-10-16(2)11-13-20/h4,6,8,10-14,19H,1,5,7,9,15H2,2-3H3/b8-6+ |
| InChIKey | CSLRPBCICLQRGS-SOFGYWHQSA-N |
| XLogP | 3.80 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|