C24H46O6Si2 — CID 134983284
methyl 2-[(3S,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidene-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-6-yl]acetate (PubChem CID 134983284) has the molecular formula C24H46O6Si2 and a molecular weight of 486.80 g/mol. Its IUPAC name is methyl 2-[(3S,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidene-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-6-yl]acetate.
| Compound Name | methyl 2-[(3S,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidene-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-6-yl]acetate |
|---|---|
| PubChem CID | 134983284 |
| Molecular Formula | C24H46O6Si2 |
| Molecular Weight | 486.80 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | methyl 2-[(3S,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidene-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-6-yl]acetate |
| SMILES | C=C1O[C@H]2CC[C@H](CC(=O)OC)O[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O6Si2/c1-16-20(29-31(9,10)23(2,3)4)22(30-32(11,12)24(5,6)7)21-18(27-16)14-13-17(28-21)15-19(25)26-8/h17-18,20-22H,1,13-15H2,2-12H3/t17-,18+,20-,21+,22-/m1/s1 |
| InChIKey | XWFYDIKWBSCUJQ-WQIFRTTPSA-N |
| XLogP | 5.79 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.80 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|