C15H13F3O3 — CID 134983298
ethyl (2E,4E)-5-phenyl-2-(2,2,2-trifluoroacetyl)penta-2,4-dienoate (PubChem CID 134983298) has the molecular formula C15H13F3O3 and a molecular weight of 298.26 g/mol. Its IUPAC name is ethyl (2E,4E)-5-phenyl-2-(2,2,2-trifluoroacetyl)penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-phenyl-2-(2,2,2-trifluoroacetyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 134983298 |
| Molecular Formula | C15H13F3O3 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | ethyl (2E,4E)-5-phenyl-2-(2,2,2-trifluoroacetyl)penta-2,4-dienoate |
| SMILES | CCOC(=O)/C(=C/C=C/c1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H13F3O3/c1-2-21-14(20)12(13(19)15(16,17)18)10-6-9-11-7-4-3-5-8-11/h3-10H,2H2,1H3/b9-6+,12-10+ |
| InChIKey | QHPJGXYUSMDQDB-LWGDNYCUSA-N |
| XLogP | 3.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|