C7H8O3 — CID 134983331
(1S,2R,5S)-2-hydroxy-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 134983331) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is (1S,2R,5S)-2-hydroxy-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,2R,5S)-2-hydroxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 134983331 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | (1S,2R,5S)-2-hydroxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | O=C1C[C@H]2C=C[C@H](O2)[C@H]1O |
| InChI | InChI=1S/C7H8O3/c8-5-3-4-1-2-6(10-4)7(5)9/h1-2,4,6-7,9H,3H2/t4-,6+,7+/m1/s1 |
| InChIKey | IPBIXUHHUFRZTN-PIYBLCFFSA-N |
| XLogP | -0.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|