C16H18O2 — CID 134983332
(3aS,6aS)-3a-hydroxy-4-(2-phenylethyl)-2,3,6,6a-tetrahydropentalen-1-one (PubChem CID 134983332) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (3aS,6aS)-3a-hydroxy-4-(2-phenylethyl)-2,3,6,6a-tetrahydropentalen-1-one.
| Compound Name | (3aS,6aS)-3a-hydroxy-4-(2-phenylethyl)-2,3,6,6a-tetrahydropentalen-1-one |
|---|---|
| PubChem CID | 134983332 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (3aS,6aS)-3a-hydroxy-4-(2-phenylethyl)-2,3,6,6a-tetrahydropentalen-1-one |
| SMILES | O=C1CC[C@@]2(O)C(CCc3ccccc3)=CC[C@H]12 |
| InChI | InChI=1S/C16H18O2/c17-15-10-11-16(18)13(8-9-14(15)16)7-6-12-4-2-1-3-5-12/h1-5,8,14,18H,6-7,9-11H2/t14-,16-/m1/s1 |
| InChIKey | OEOIBFLZGTZYJP-GDBMZVCRSA-N |
| XLogP | 2.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|