C24H24O4 — CID 134983365
dimethyl 7,8,10,12-tetramethylbenzo[a]heptalene-2,3-dicarboxylate (PubChem CID 134983365) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is dimethyl 7,8,10,12-tetramethylbenzo[a]heptalene-2,3-dicarboxylate.
| Compound Name | dimethyl 7,8,10,12-tetramethylbenzo[a]heptalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134983365 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | dimethyl 7,8,10,12-tetramethylbenzo[a]heptalene-2,3-dicarboxylate |
| SMILES | COC(=O)c1cc2c(cc1C(=O)OC)=C1C(C)=CC(C)=CC(C)=C1C(C)=CC=2 |
| InChI | InChI=1S/C24H24O4/c1-13-9-15(3)21-14(2)7-8-17-11-19(23(25)27-5)20(24(26)28-6)12-18(17)22(21)16(4)10-13/h7-12H,1-6H3 |
| InChIKey | GQGWNJOWKGZQSV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |