C10H18O — CID 134983381
(2Z,4E)-3-methylnona-2,4-dien-1-ol (PubChem CID 134983381) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (2Z,4E)-3-methylnona-2,4-dien-1-ol.
| Compound Name | (2Z,4E)-3-methylnona-2,4-dien-1-ol |
|---|---|
| PubChem CID | 134983381 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (2Z,4E)-3-methylnona-2,4-dien-1-ol |
| SMILES | CCCC/C=C/C(C)=C\CO |
| InChI | InChI=1S/C10H18O/c1-3-4-5-6-7-10(2)8-9-11/h6-8,11H,3-5,9H2,1-2H3/b7-6+,10-8- |
| InChIKey | OWWZZZWVSPPQBK-QDJLDCPTSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|