C30H46O — CID 134983425
2-[(1E,3E,5E,7E)-9-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene (PubChem CID 134983425) has the molecular formula C30H46O and a molecular weight of 422.70 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-9-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7E)-9-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 134983425 |
| Molecular Formula | C30H46O |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.35 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-9-[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC(C)=CCC/C(C)=C/COC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C30H46O/c1-24(2)12-9-13-26(4)19-22-31-23-20-27(5)15-10-14-25(3)17-18-29-28(6)16-11-21-30(29,7)8/h10,12,14-15,17-20H,9,11,13,16,21-23H2,1-8H3/b15-10+,18-17+,25-14+,26-19+,27-20+ |
| InChIKey | GGMHFCMMMSJQBB-XYJLZTSTSA-N |
| XLogP | 9.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|