About 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene
13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene (PubChem CID 134983427) has the molecular formula C14H22S
and a molecular weight of 222.40 g/mol. Its IUPAC name is 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene.
Molecular Properties
| Compound Name | 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene |
| PubChem CID | 134983427 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene |
| SMILES | Cc1sc2cc1CCCCCCCCC2 |
| InChI | InChI=1S/C14H22S/c1-12-13-9-7-5-3-2-4-6-8-10-14(11-13)15-12/h11H,2-10H2,1H3 |
| InChIKey | FLIJHGMNGCLQRM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene?
The IUPAC name of 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene (CID 134983427) is 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene.
What is the SMILES notation for 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene?
The canonical SMILES for 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene is Cc1sc2cc1CCCCCCCCC2.
What is the InChIKey of 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene?
The InChIKey is FLIJHGMNGCLQRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22S/c1-12-13-9-7-5-3-2-4-6-8-10-14(11-13)15-12/h11H,2-10H2,1H3.
What are the key properties of 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene?
13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene has a molecular weight of 222.40 g/mol, XLogP of 4.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 13-methyl-12-thiabicyclo[9.2.1]tetradeca-1(13),11(14)-diene is sourced from PubChem (CID 134983427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).