About methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate
methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate (PubChem CID 134983523) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate.
Molecular Properties
| Compound Name | methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate |
| PubChem CID | 134983523 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate |
| SMILES | CCO[C@]12C=C[C@H](C=C1C(=O)OC)CCCC2 |
| InChI | InChI=1S/C14H20O3/c1-3-17-14-8-5-4-6-11(7-9-14)10-12(14)13(15)16-2/h7,9-11H,3-6,8H2,1-2H3/t11-,14-/m1/s1 |
| InChIKey | SWFKTTPHCKYOMT-BXUZGUMPSA-N |
| XLogP | 2.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate?
The IUPAC name of methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate (CID 134983523) is methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate.
What is the SMILES notation for methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate?
The canonical SMILES for methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate is CCO[C@]12C=C[C@H](C=C1C(=O)OC)CCCC2.
What is the InChIKey of methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate?
The InChIKey is SWFKTTPHCKYOMT-BXUZGUMPSA-N. The full InChI is InChI=1S/C14H20O3/c1-3-17-14-8-5-4-6-11(7-9-14)10-12(14)13(15)16-2/h7,9-11H,3-6,8H2,1-2H3/t11-,14-/m1/s1.
What are the key properties of methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate?
methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate has a molecular weight of 236.31 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R,6R)-6-ethoxybicyclo[4.2.2]deca-7,9-diene-7-carboxylate is sourced from PubChem (CID 134983523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).