C12H14O4 — CID 13498353
ethyl 2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate (PubChem CID 13498353) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is ethyl 2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate.
| Compound Name | ethyl 2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 13498353 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | ethyl 2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(C)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C12H14O4/c1-5-16-12(15)9-8(4)10(13)6(2)7(3)11(9)14/h5H2,1-4H3 |
| InChIKey | RDQVAKXTXQSRBM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|