About (1Z)-1,2-dipentylcyclooctene
(1Z)-1,2-dipentylcyclooctene (PubChem CID 134983640) has the molecular formula C18H34
and a molecular weight of 250.47 g/mol. Its IUPAC name is (1Z)-1,2-dipentylcyclooctene.
Molecular Properties
| Compound Name | (1Z)-1,2-dipentylcyclooctene |
| PubChem CID | 134983640 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | (1Z)-1,2-dipentylcyclooctene |
| SMILES | CCCCC/C1=C(\CCCCC)CCCCCC1 |
| InChI | InChI=1S/C18H34/c1-3-5-9-13-17-15-11-7-8-12-16-18(17)14-10-6-4-2/h3-16H2,1-2H3/b18-17- |
| InChIKey | MUJKNILNVIXJRI-ZCXUNETKSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1,2-dipentylcyclooctene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1,2-dipentylcyclooctene?
The IUPAC name of (1Z)-1,2-dipentylcyclooctene (CID 134983640) is (1Z)-1,2-dipentylcyclooctene.
What is the SMILES notation for (1Z)-1,2-dipentylcyclooctene?
The canonical SMILES for (1Z)-1,2-dipentylcyclooctene is CCCCC/C1=C(\CCCCC)CCCCCC1.
What is the InChIKey of (1Z)-1,2-dipentylcyclooctene?
The InChIKey is MUJKNILNVIXJRI-ZCXUNETKSA-N. The full InChI is InChI=1S/C18H34/c1-3-5-9-13-17-15-11-7-8-12-16-18(17)14-10-6-4-2/h3-16H2,1-2H3/b18-17-.
What are the key properties of (1Z)-1,2-dipentylcyclooctene?
(1Z)-1,2-dipentylcyclooctene has a molecular weight of 250.47 g/mol, XLogP of 6.80, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1,2-dipentylcyclooctene is sourced from PubChem (CID 134983640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).