C27H38O5 — CID 134983705
diethyl (3E,5Z)-4-(phenoxymethyl)-5,6-dipropylcycloocta-3,5-diene-1,1-dicarboxylate (PubChem CID 134983705) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is diethyl (3E,5Z)-4-(phenoxymethyl)-5,6-dipropylcycloocta-3,5-diene-1,1-dicarboxylate.
| Compound Name | diethyl (3E,5Z)-4-(phenoxymethyl)-5,6-dipropylcycloocta-3,5-diene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134983705 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | diethyl (3E,5Z)-4-(phenoxymethyl)-5,6-dipropylcycloocta-3,5-diene-1,1-dicarboxylate |
| SMILES | CCC/C1=C(CCC)/C(COc2ccccc2)=C\CC(C(=O)OCC)(C(=O)OCC)CC1 |
| InChI | InChI=1S/C27H38O5/c1-5-12-21-16-18-27(25(28)30-7-3,26(29)31-8-4)19-17-22(24(21)13-6-2)20-32-23-14-10-9-11-15-23/h9-11,14-15,17H,5-8,12-13,16,18-20H2,1-4H3/b22-17-,24-21- |
| InChIKey | NTHMCRMZJYKXOT-CCLMEWPCSA-N |
| XLogP | 6.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|