C18H34O4Si — CID 134983707
tert-butyl-[(1Z,3Z)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylpenta-1,3-dien-2-yl]oxy-dimethylsilane (PubChem CID 134983707) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is tert-butyl-[(1Z,3Z)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylpenta-1,3-dien-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1Z,3Z)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylpenta-1,3-dien-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134983707 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | tert-butyl-[(1Z,3Z)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-methoxy-3-methylpenta-1,3-dien-2-yl]oxy-dimethylsilane |
| SMILES | CO/C=C(O[Si](C)(C)C(C)(C)C)/C(C)=C(/C)C1COC(C)(C)O1 |
| InChI | InChI=1S/C18H34O4Si/c1-13(15-12-20-18(6,7)21-15)14(2)16(11-19-8)22-23(9,10)17(3,4)5/h11,15H,12H2,1-10H3/b14-13-,16-11- |
| InChIKey | HUHKABMWQCCVEF-FXODQPBSSA-N |
| XLogP | 4.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|