About 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine
3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine (PubChem CID 134984789) has the molecular formula C15H28N4O8
and a molecular weight of 392.41 g/mol. Its IUPAC name is 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine.
Molecular Properties
| Compound Name | 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine |
| PubChem CID | 134984789 |
| Molecular Formula | C15H28N4O8 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine |
| SMILES | CCCCCC(C[N+](=O)[O-])ON1OC(CCCCC)CC1([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C15H28N4O8/c1-3-5-7-9-13-11-15(17(22)23,18(24)25)19(26-13)27-14(12-16(20)21)10-8-6-4-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | WVJCOCGHFLQZRT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 151.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine?
The IUPAC name of 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine (CID 134984789) is 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine.
What is the SMILES notation for 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine?
The canonical SMILES for 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine is CCCCCC(C[N+](=O)[O-])ON1OC(CCCCC)CC1([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine?
The InChIKey is WVJCOCGHFLQZRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4O8/c1-3-5-7-9-13-11-15(17(22)23,18(24)25)19(26-13)27-14(12-16(20)21)10-8-6-4-2/h13-14H,3-12H2,1-2H3.
What are the key properties of 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine?
3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine has a molecular weight of 392.41 g/mol, XLogP of 2.94, 14 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dinitro-2-(1-nitroheptan-2-yloxy)-5-pentyl-1,2-oxazolidine is sourced from PubChem (CID 134984789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).