About 4-nitro-3,3-diphenylbutanenitrile
4-nitro-3,3-diphenylbutanenitrile (PubChem CID 134985025) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-nitro-3,3-diphenylbutanenitrile.
Molecular Properties
| Compound Name | 4-nitro-3,3-diphenylbutanenitrile |
| PubChem CID | 134985025 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-nitro-3,3-diphenylbutanenitrile |
| SMILES | N#CCC(C[N+](=O)[O-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O2/c17-12-11-16(13-18(19)20,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10H,11,13H2 |
| InChIKey | MMJRENFSBVLISC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-3,3-diphenylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-3,3-diphenylbutanenitrile?
The IUPAC name of 4-nitro-3,3-diphenylbutanenitrile (CID 134985025) is 4-nitro-3,3-diphenylbutanenitrile.
What is the SMILES notation for 4-nitro-3,3-diphenylbutanenitrile?
The canonical SMILES for 4-nitro-3,3-diphenylbutanenitrile is N#CCC(C[N+](=O)[O-])(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-nitro-3,3-diphenylbutanenitrile?
The InChIKey is MMJRENFSBVLISC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c17-12-11-16(13-18(19)20,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10H,11,13H2.
What are the key properties of 4-nitro-3,3-diphenylbutanenitrile?
4-nitro-3,3-diphenylbutanenitrile has a molecular weight of 266.30 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-3,3-diphenylbutanenitrile is sourced from PubChem (CID 134985025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).