About methyl 3-methoxyheptanoate
methyl 3-methoxyheptanoate (PubChem CID 13498510) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is methyl 3-methoxyheptanoate.
Molecular Properties
| Compound Name | methyl 3-methoxyheptanoate |
| PubChem CID | 13498510 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | methyl 3-methoxyheptanoate |
| SMILES | CCCCC(CC(=O)OC)OC |
| InChI | InChI=1S/C9H18O3/c1-4-5-6-8(11-2)7-9(10)12-3/h8H,4-7H2,1-3H3 |
| InChIKey | CXNQFMYELOJOIK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-methoxyheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methoxyheptanoate?
The IUPAC name of methyl 3-methoxyheptanoate (CID 13498510) is methyl 3-methoxyheptanoate.
What is the SMILES notation for methyl 3-methoxyheptanoate?
The canonical SMILES for methyl 3-methoxyheptanoate is CCCCC(CC(=O)OC)OC.
What is the InChIKey of methyl 3-methoxyheptanoate?
The InChIKey is CXNQFMYELOJOIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-4-5-6-8(11-2)7-9(10)12-3/h8H,4-7H2,1-3H3.
What are the key properties of methyl 3-methoxyheptanoate?
methyl 3-methoxyheptanoate has a molecular weight of 174.24 g/mol, XLogP of 1.75, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methoxyheptanoate is sourced from PubChem (CID 13498510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).