C20H25NO — CID 134985153
(3R,5S)-2-tert-butyl-5-methyl-3,5-diphenyl-1,2-oxazolidine (PubChem CID 134985153) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is (3R,5S)-2-tert-butyl-5-methyl-3,5-diphenyl-1,2-oxazolidine.
| Compound Name | (3R,5S)-2-tert-butyl-5-methyl-3,5-diphenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 134985153 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (3R,5S)-2-tert-butyl-5-methyl-3,5-diphenyl-1,2-oxazolidine |
| SMILES | CC(C)(C)N1O[C@](C)(c2ccccc2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H25NO/c1-19(2,3)21-18(16-11-7-5-8-12-16)15-20(4,22-21)17-13-9-6-10-14-17/h5-14,18H,15H2,1-4H3/t18-,20+/m1/s1 |
| InChIKey | DQOBIBFZPISIEU-QUCCMNQESA-N |
| XLogP | 5.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |