C21H36N2O3 — CID 134985440
(Z)-8-[6-[(E,3R)-3-hydroxyoct-1-enyl]-2,3-diazabicyclo[2.2.1]heptan-5-yl]oct-6-enoic acid (PubChem CID 134985440) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is (Z)-8-[6-[(E,3R)-3-hydroxyoct-1-enyl]-2,3-diazabicyclo[2.2.1]heptan-5-yl]oct-6-enoic acid.
| Compound Name | (Z)-8-[6-[(E,3R)-3-hydroxyoct-1-enyl]-2,3-diazabicyclo[2.2.1]heptan-5-yl]oct-6-enoic acid |
|---|---|
| PubChem CID | 134985440 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | (Z)-8-[6-[(E,3R)-3-hydroxyoct-1-enyl]-2,3-diazabicyclo[2.2.1]heptan-5-yl]oct-6-enoic acid |
| SMILES | CCCCC[C@@H](O)/C=C/C1C2CC(NN2)C1C/C=C\CCCCC(=O)O |
| InChI | InChI=1S/C21H36N2O3/c1-2-3-7-10-16(24)13-14-18-17(19-15-20(18)23-22-19)11-8-5-4-6-9-12-21(25)26/h5,8,13-14,16-20,22-24H,2-4,6-7,9-12,15H2,1H3,(H,25,26)/b8-5-,14-13+/t16-,17?,18?,19?,20?/m1/s1 |
| InChIKey | HOVPSVVVEZZBBD-QHPZWZOOSA-N |
| XLogP | 3.56 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|