C15H25NO4SSi — CID 134985590
methyl (2S)-3-phenyl-2-(2-trimethylsilylethylsulfonylamino)propanoate (PubChem CID 134985590) has the molecular formula C15H25NO4SSi and a molecular weight of 343.52 g/mol. Its IUPAC name is methyl (2S)-3-phenyl-2-(2-trimethylsilylethylsulfonylamino)propanoate.
| Compound Name | methyl (2S)-3-phenyl-2-(2-trimethylsilylethylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 134985590 |
| Molecular Formula | C15H25NO4SSi |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | methyl (2S)-3-phenyl-2-(2-trimethylsilylethylsulfonylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NS(=O)(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C15H25NO4SSi/c1-20-15(17)14(12-13-8-6-5-7-9-13)16-21(18,19)10-11-22(2,3)4/h5-9,14,16H,10-12H2,1-4H3/t14-/m0/s1 |
| InChIKey | MSOAWOCNPKWPMT-AWEZNQCLSA-N |
| XLogP | 2.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|