About (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine
(3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine (PubChem CID 134985643) has the molecular formula C20H25NO
and a molecular weight of 295.43 g/mol. Its IUPAC name is (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine.
Molecular Properties
| Compound Name | (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine |
| PubChem CID | 134985643 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine |
| SMILES | Cc1ccc([C@@H]2C[C@H](c3ccccc3)N(C(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C20H25NO/c1-15-10-12-17(13-11-15)19-14-18(16-8-6-5-7-9-16)21(22-19)20(2,3)4/h5-13,18-19H,14H2,1-4H3/t18-,19+/m1/s1 |
| InChIKey | VOSHYNYKQZCCED-MOPGFXCFSA-N |
| XLogP | 5.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine?
The IUPAC name of (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine (CID 134985643) is (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine.
What is the SMILES notation for (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine?
The canonical SMILES for (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine is Cc1ccc([C@@H]2C[C@H](c3ccccc3)N(C(C)(C)C)O2)cc1.
What is the InChIKey of (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine?
The InChIKey is VOSHYNYKQZCCED-MOPGFXCFSA-N. The full InChI is InChI=1S/C20H25NO/c1-15-10-12-17(13-11-15)19-14-18(16-8-6-5-7-9-16)21(22-19)20(2,3)4/h5-13,18-19H,14H2,1-4H3/t18-,19+/m1/s1.
What are the key properties of (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine?
(3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine has a molecular weight of 295.43 g/mol, XLogP of 5.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-2-tert-butyl-5-(4-methylphenyl)-3-phenyl-1,2-oxazolidine is sourced from PubChem (CID 134985643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).