C9H12O3 — CID 134985667
1-[5-methyl-2-[(Z)-prop-1-enyl]-1,3-dioxol-4-yl]ethanone (PubChem CID 134985667) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 1-[5-methyl-2-[(Z)-prop-1-enyl]-1,3-dioxol-4-yl]ethanone.
| Compound Name | 1-[5-methyl-2-[(Z)-prop-1-enyl]-1,3-dioxol-4-yl]ethanone |
|---|---|
| PubChem CID | 134985667 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1-[5-methyl-2-[(Z)-prop-1-enyl]-1,3-dioxol-4-yl]ethanone |
| SMILES | C/C=C\C1OC(C)=C(C(C)=O)O1 |
| InChI | InChI=1S/C9H12O3/c1-4-5-8-11-7(3)9(12-8)6(2)10/h4-5,8H,1-3H3/b5-4- |
| InChIKey | XBZXCRHYLLMPDL-PLNGDYQASA-N |
| XLogP | 1.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|